175205-37-5 Usage
General Description
4-N-butyl-2-methylphenyl isothiocyanate is a chemical compound that belongs to the family of isothiocyanates, which are known for their potential use as anticancer agents. 4-N-BUTYL-2-METHYLPHENYL ISOTHIOCYANATE is derived from the reaction of a specific aromatic amine with carbon disulfide, followed by the addition of a primary alkyl halide. It is commonly used in the synthesis of novel antitumor agents and has demonstrated cytotoxic effects on various cancer cell lines. Additionally, it has been found to exhibit strong inhibitory activity against certain enzymes involved in the development of cancer, making it a promising candidate for further research and development in the field of oncology.
Check Digit Verification of cas no
The CAS Registry Mumber 175205-37-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 5 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 175205-37:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*5)+(2*3)+(1*7)=125
125 % 10 = 5
So 175205-37-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H15NS/c1-3-4-5-11-6-7-12(13-9-14)10(2)8-11/h6-8H,3-5H2,1-2H3