175205-49-9 Usage
Uses
Used in Pharmaceutical Research:
4-(1,2,3-THIADIAZOL-4-YL)BENZYLAMINE HYDROCHLORIDE is used as a research compound for its potential biological activity. It is employed in the development of new pharmaceuticals, particularly in the discovery and optimization of drug candidates with therapeutic potential.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 4-(1,2,3-THIADIAZOL-4-YL)BENZYLAMINE HYDROCHLORIDE is used as a building block or intermediate in the synthesis of various bioactive molecules. Its unique chemical structure allows for the design and synthesis of novel compounds with potential applications in treating various diseases and conditions.
Used in Drug Development:
4-(1,2,3-THIADIAZOL-4-YL)BENZYLAMINE HYDROCHLORIDE is utilized in drug development as a potential active pharmaceutical ingredient (API). Its biological activity and chemical properties make it a promising candidate for further investigation and development into effective therapeutic agents.
Used in Chemical Synthesis:
In the chemical synthesis industry, 4-(1,2,3-THIADIAZOL-4-YL)BENZYLAMINE HYDROCHLORIDE is used as a reagent or precursor in the production of other organic compounds. Its versatile chemical structure allows for various synthetic routes and transformations, contributing to the synthesis of a wide range of chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 175205-49-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 5 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 175205-49:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*5)+(2*4)+(1*9)=129
129 % 10 = 9
So 175205-49-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3S.ClH/c10-5-7-1-3-8(4-2-7)9-6-13-12-11-9;/h1-4,6H,5,10H2;1H
