175205-50-2 Usage
Uses
Used in Organic Chemistry:
1-(3,5-DICHLOROPHENYL)-2,5-DIMETHYL-1H-PYRROLE is used as a building block for the synthesis of more complex organic molecules. Its unique structure allows for the creation of a variety of compounds with different properties and potential applications.
Used in Material Science:
In the field of material science, 1-(3,5-DICHLOROPHENYL)-2,5-DIMETHYL-1H-PYRROLE is used for the development of new materials. Its interesting properties make it a promising candidate for the creation of advanced materials with specific characteristics for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 175205-50-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 5 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 175205-50:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*5)+(2*5)+(1*0)=122
122 % 10 = 2
So 175205-50-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H11Cl2N/c1-8-3-4-9(2)15(8)12-6-10(13)5-11(14)7-12/h3-7H,1-2H3
