175205-52-4 Usage
Uses
Used in Pharmaceutical Industry:
4-(1,2,3-Thiadiazol-4-yl)benzene-1-carbothioamide is used as a potential antitumor agent for its ability to target and inhibit the growth of cancer cells. Its unique chemical structure allows it to interact with cellular components and signaling pathways, making it a promising candidate for the development of new cancer therapies.
Used in Antifungal Applications:
4-(1,2,3-Thiadiazol-4-yl)benzene-1-carbothioamide is used as an antifungal agent to combat fungal infections. Its chemical properties enable it to disrupt the growth and reproduction of fungi, making it a potential candidate for the development of new antifungal drugs.
Used in Antimicrobial Applications:
4-(1,2,3-Thiadiazol-4-yl)benzene-1-carbothioamide is used as an antimicrobial agent to target and eliminate bacteria. Its chemical structure allows it to interfere with bacterial cell functions, making it a potential candidate for the development of new antimicrobial drugs.
Used in Antioxidant Applications:
4-(1,2,3-Thiadiazol-4-yl)benzene-1-carbothioamide is used as an antioxidant agent to protect cells from oxidative damage. Its chemical properties enable it to neutralize reactive oxygen species and prevent oxidative stress, making it a potential candidate for the development of new antioxidant therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 175205-52-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 5 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 175205-52:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*5)+(2*5)+(1*2)=124
124 % 10 = 4
So 175205-52-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H7N3S2/c10-9(13)7-3-1-6(2-4-7)8-5-14-12-11-8/h1-5H,(H2,10,13)
