175205-53-5 Usage
Uses
Used in Pharmaceutical Research:
4-(1,2,3-Thiadiazol-4-yl)benzamide is utilized as a key building block in the synthesis of biologically active molecules, contributing to the development of potential drugs for the treatment of various medical conditions. Its structural attributes make it a versatile component in the creation of novel therapeutic agents.
Used in Drug Discovery and Development:
In the field of drug discovery and development, 4-(1,2,3-Thiadiazol-4-yl)benzamide is employed as a valuable tool. Its chemical properties allow it to be integrated into the design and synthesis of new drug candidates, potentially leading to the discovery of effective treatments for a range of diseases and disorders.
Used in Medicinal Chemistry:
4-(1,2,3-Thiadiazol-4-yl)benzamide is applied in medicinal chemistry as a component in the design of new chemical entities. Its presence in these entities can influence their pharmacological properties, such as potency, selectivity, and pharmacokinetics, which are crucial for their therapeutic efficacy and safety.
Used in Chemical Synthesis:
In the realm of chemical synthesis, 4-(1,2,3-Thiadiazol-4-yl)benzamide is used as a reactant or intermediate in the preparation of complex organic compounds. Its reactivity and functional group compatibility make it suitable for various synthetic routes and methodologies, broadening its applicability in the synthesis of pharmaceuticals and other specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 175205-53-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 5 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 175205-53:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*5)+(2*5)+(1*3)=125
125 % 10 = 5
So 175205-53-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H7N3OS/c10-9(13)7-3-1-6(2-4-7)8-5-14-12-11-8/h1-5H,(H2,10,13)
