175205-65-9 Usage
Uses
Used in Pharmaceutical Industry:
3-(2-Thienyl)isoxazole serves as an essential intermediate in the synthesis of various pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs, contributing to the advancement of medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 3-(2-Thienyl)isoxazole is utilized as an intermediate in the production of agrochemicals. Its incorporation into these products can enhance their effectiveness in agricultural applications, such as pest control and crop protection.
Used in Biological Research:
3-(2-Thienyl)isoxazole has been studied for its potential biological activities, including its ability to inhibit certain enzymes and receptors. This makes it a valuable compound for research in the fields of biology and pharmacology, where understanding its interactions with biological targets can lead to the discovery of new therapeutic agents.
Used in Material Science:
3-(2-Thienyl)isoxazole has been investigated for its potential as a building block in the development of new materials and dyes. Its unique structure and properties make it a promising candidate for creating innovative materials with specific characteristics, such as improved stability or novel optical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 175205-65-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 5 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 175205-65:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*5)+(2*6)+(1*5)=129
129 % 10 = 9
So 175205-65-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H5NOS/c1-2-7(10-5-1)6-3-4-9-8-6/h1-5H
