175205-78-4 Usage
Uses
Used in Pharmaceutical Industry:
5-(METHYLTHIO)THIOPHENE-2-CARBONITRILE is used as a key intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of complex organic molecules with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 5-(METHYLTHIO)THIOPHENE-2-CARBONITRILE serves as an intermediate in the production of various agrochemicals, leveraging its chemical properties to enhance the effectiveness of these compounds in agricultural applications.
Used in Organic Electronics:
5-(METHYLTHIO)THIOPHENE-2-CARBONITRILE is utilized in the field of organic electronics due to its electronic properties, which are valuable for the creation of components in electronic devices and materials.
Used in Materials Science:
5-(METHYLTHIO)THIOPHENE-2-CARBONITRILE is also used as a building block in materials science, where its unique optical properties are harnessed for the development of advanced materials with specific characteristics for various applications.
Synthesis:
5-(METHYLTHIO)THIOPHENE-2-CARBONITRILE is typically synthesized through a series of organic reactions starting from readily available starting materials, highlighting its accessibility and the potential for large-scale production in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 175205-78-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 5 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 175205-78:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*5)+(2*7)+(1*8)=134
134 % 10 = 4
So 175205-78-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H5NS2/c1-8-6-3-2-5(4-7)9-6/h2-3H,1H3
