175276-48-9 Usage
General Description
Methyl 4-acetyl-1,2,5-trimethyl-1H-pyrrole-3-carboxylate is a chemical compound with the molecular formula C14H17NO3. It is a pyrrole derivative and is commonly used in organic synthesis and pharmaceutical research. METHYL 4-ACETYL-1,2,5-TRIMETHYL-1H-PYRROLE-3-CARBOXYLATE is known to exhibit anti-inflammatory and antibacterial properties, making it a potential candidate for the development of new drugs. The structure of methyl 4-acetyl-1,2,5-trimethyl-1H-pyrrole-3-carboxylate allows it to interact with biological systems, suggesting its potential as a pharmacologically active compound. However, further research is needed to fully understand its pharmaceutical properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 175276-48-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 6 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 175276-48:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*6)+(2*4)+(1*8)=159
159 % 10 = 9
So 175276-48-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H15NO3/c1-6-9(8(3)13)10(11(14)15-5)7(2)12(6)4/h1-5H3