175276-52-5 Usage
Uses
Used in Organic Synthesis:
Ethyl 4-formyl-2,5-dimethyl-1-phenyl-1H-pyrrole-3-carboxylate serves as a key intermediate in organic synthesis, utilized for the creation of a variety of complex chemical structures. Its presence in these reactions is crucial for the formation of desired products with specific properties.
Used in Pharmaceutical Research:
In the pharmaceutical industry, ethyl 4-formyl-2,5-dimethyl-1-phenyl-1H-pyrrole-3-carboxylate is employed as a building block for the development of new drugs. Its unique molecular structure contributes to the design of innovative therapeutic agents with potential applications in treating various diseases and conditions.
Used in Material Science:
ethyl 4-formyl-2,5-dimethyl-1-phenyl-1H-pyrrole-3-carboxylate also finds application in material science, where its distinctive properties are leveraged to develop new materials with specific characteristics, such as improved stability, reactivity, or other desirable traits for various industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 175276-52-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 6 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 175276-52:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*6)+(2*5)+(1*2)=155
155 % 10 = 5
So 175276-52-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H17NO3/c1-4-20-16(19)15-12(3)17(11(2)14(15)10-18)13-8-6-5-7-9-13/h5-10H,4H2,1-3H3
