175276-74-1 Usage
Uses
Used in Pharmaceutical Industry:
2-Chloro-6-fluorophenylhydrazine is used as a reagent for the synthesis of various pharmaceuticals. It plays a crucial role in the production of drugs due to its ability to form intermediates that are key in the development of new medicinal compounds.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Chloro-6-fluorophenylhydrazine is utilized as a reagent in the synthesis of agrochemicals. Its involvement in the creation of these compounds contributes to the development of products that protect crops and enhance agricultural productivity.
Used in Dye Industry:
2-Chloro-6-fluorophenylhydrazine is employed as a reagent in the production of dyes. Its chemical properties allow for the creation of a range of dyes used in various applications, including textiles and other industrial processes.
Used in Polymer Production:
2-Chloro-6-fluorophenylhydrazine is also used in the synthesis of polymers, contributing to the development of new materials with specific properties for use in various industries, such as plastics, coatings, and adhesives.
Check Digit Verification of cas no
The CAS Registry Mumber 175276-74-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 6 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 175276-74:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*6)+(2*7)+(1*4)=161
161 % 10 = 1
So 175276-74-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H6ClFN2/c7-4-2-1-3-5(8)6(4)10-9/h1-3,10H,9H2
