175276-76-3 Usage
Uses
Used in Pharmaceutical Research:
2-(2,6-Dichlorophenyl)ethanimidamide hydrochloride is used as a research chemical for the development of new drugs or therapeutic agents. Its unique structure and functional groups make it a valuable candidate for exploring its potential in treating various diseases and conditions.
Used in Biotechnology Research:
In the biotechnology industry, 2-(2,6-Dichlorophenyl)ethanimidamide hydrochloride is used as a research tool to study its interactions with biological systems. This can help in understanding its potential applications in the development of new therapies or diagnostic tools.
Check Digit Verification of cas no
The CAS Registry Mumber 175276-76-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 6 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 175276-76:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*6)+(2*7)+(1*6)=163
163 % 10 = 3
So 175276-76-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H8Cl2N2.ClH/c9-6-2-1-3-7(10)5(6)4-8(11)12;/h1-3H,4H2,(H3,11,12);1H