175276-86-5 Usage
Uses
Used in Pharmaceutical Industry:
ETHYL 2-(2,3-DICHLOROPHENYL)-1,3-THIAZOLE-4-CARBOXYLATE is used as a pharmaceutical intermediate for the synthesis of various therapeutic agents. Its unique structure and properties contribute to the development of new drugs with potential applications in treating a range of medical conditions.
Used in Agrochemical Industry:
In the agrochemical sector, ETHYL 2-(2,3-DICHLOROPHENYL)-1,3-THIAZOLE-4-CARBOXYLATE is utilized as an intermediate in the production of agrochemicals. Its chemical properties make it suitable for the development of compounds with pesticidal or herbicidal activities, contributing to enhanced crop protection and yield.
Used in Materials Science:
ETHYL 2-(2,3-DICHLOROPHENYL)-1,3-THIAZOLE-4-CARBOXYLATE is employed in materials science for the development of new materials with specific properties. Its chemical structure allows for the creation of materials with potential applications in various industries, such as electronics, coatings, and adhesives.
Used as a Building Block in Organic Synthesis:
ETHYL 2-(2,3-DICHLOROPHENYL)-1,3-THIAZOLE-4-CARBOXYLATE serves as a building block in the synthesis of various organic compounds. Its versatile chemical properties enable the creation of a wide range of chemical entities, expanding the scope of chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 175276-86-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 6 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 175276-86:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*6)+(2*8)+(1*6)=165
165 % 10 = 5
So 175276-86-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H9Cl2NO2S/c1-2-17-12(16)9-6-18-11(15-9)7-4-3-5-8(13)10(7)14/h3-6H,2H2,1H3
