175276-87-6 Usage
Uses
Used in Pharmaceutical Research:
2-(2,3-Dichlorophenyl)-1,3-thiazole-4-carbohydrazide is used as a building block in the synthesis of various heterocyclic compounds, which are essential in the development of new drugs. Its unique structure allows for the creation of novel compounds with potential therapeutic applications.
Used in Antibacterial and Antifungal Applications:
2-(2,3-DICHLOROPHENYL)-1,3-THIAZOLE-4-CARBOHYDRAZIDE exhibits antibacterial and antifungal activities, making it a promising candidate for the development of new antimicrobial agents. Its ability to target and inhibit the growth of harmful microorganisms can contribute to the advancement of treatments for various infections.
Used in Corrosion Inhibition:
2-(2,3-Dichlorophenyl)-1,3-thiazole-4-carbohydrazide has been studied for its potential role as a corrosion inhibitor in metal protection. Its application in this field can help prevent the degradation of metal surfaces, extending their lifespan and improving their performance in various industries.
Used in Organic Synthesis:
In the field of organic synthesis, 2-(2,3-Dichlorophenyl)-1,3-thiazole-4-carbohydrazide serves as a versatile intermediate for the production of a wide range of chemical compounds. Its reactivity and functional groups enable the synthesis of various organic molecules with diverse applications in industries such as pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 175276-87-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 6 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 175276-87:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*6)+(2*8)+(1*7)=166
166 % 10 = 6
So 175276-87-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H7Cl2N3OS/c11-6-3-1-2-5(8(6)12)10-14-7(4-17-10)9(16)15-13/h1-4H,13H2,(H,15,16)
