175276-97-8 Usage
Uses
Used in Pharmaceutical Development:
2-(2,4-DIFLUOROPHENYL)THIAZOLE-4-CARBOXAMIDE is utilized as a key component in the design and synthesis of new pharmaceuticals. Its unique structure and functional groups contribute to its potential as a lead compound in drug discovery, targeting various biological pathways and mechanisms relevant to disease treatment.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 2-(2,4-DIFLUOROPHENYL)THIAZOLE-4-CARBOXAMIDE serves as a valuable research tool. It is employed in the study of structure-activity relationships, helping scientists understand how modifications to its molecular structure can influence its biological activity and therapeutic potential.
Used in Drug Discovery Efforts:
2-(2,4-DIFLUOROPHENYL)THIAZOLE-4-CARBOXAMIDE is leveraged in drug discovery efforts to identify novel therapeutic agents. Its chemical properties and interactions with biological targets make it a promising candidate for the development of treatments for a range of diseases and conditions.
Used in Biological Studies:
2-(2,4-DIFLUOROPHENYL)THIAZOLE-4-CARBOXAMIDE is also used in various biological studies to explore its interactions with cellular and molecular components. Such studies can provide insights into its potential mechanisms of action and inform the optimization of its therapeutic properties.
Check Digit Verification of cas no
The CAS Registry Mumber 175276-97-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 6 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 175276-97:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*6)+(2*9)+(1*7)=168
168 % 10 = 8
So 175276-97-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H6F2N2OS/c11-5-1-2-6(7(12)3-5)10-14-8(4-16-10)9(13)15/h1-4H,(H2,13,15)
