175277-38-0 Usage
Uses
Used in Pharmaceutical Research and Development:
2-BROMO-1-[3-(3,4-DICHLOROPHENYL)ISOXAZOL-5-YL]ETHAN-1-ONE is used as a chemical intermediate for the development of drugs targeting specific biological pathways. Its unique structure and functional groups make it a promising candidate for the creation of new therapeutic agents.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 2-BROMO-1-[3-(3,4-DICHLOROPHENYL)ISOXAZOL-5-YL]ETHAN-1-ONE is employed as a building block for the synthesis of novel compounds with potential therapeutic applications. Its versatility in chemical reactions allows for the exploration of various chemical modifications to enhance its pharmacological properties.
Used in Biological Research:
2-BROMO-1-[3-(3,4-DICHLOROPHENYL)ISOXAZOL-5-YL]ETHAN-1-ONE serves as a valuable tool in biological research, particularly for studying the interactions between small molecules and biological targets. Its molecular structure allows for the investigation of its binding affinity and selectivity towards specific proteins or enzymes, which can provide insights into the development of targeted therapies.
Used in Chemical Synthesis:
In the realm of chemical synthesis, 2-BROMO-1-[3-(3,4-DICHLOROPHENYL)ISOXAZOL-5-YL]ETHAN-1-ONE is utilized as a key component in the preparation of complex organic molecules. Its reactivity and functional groups enable the formation of diverse chemical products, which can be further explored for their potential applications in various industries.
Used in Drug Discovery:
2-BROMO-1-[3-(3,4-DICHLOROPHENYL)ISOXAZOL-5-YL]ETHAN-1-ONE is employed in drug discovery processes to identify new lead compounds with therapeutic potential. Its unique chemical properties and interactions with biological targets make it a valuable starting point for the development of innovative pharmaceuticals.
Used in Chemical Education:
In educational settings, 2-BROMO-1-[3-(3,4-DICHLOROPHENYL)ISOXAZOL-5-YL]ETHAN-1-ONE can be used as a teaching aid to demonstrate the principles of organic chemistry, chemical reactions, and the design of pharmaceutical agents. Its structure and properties provide a practical example for students to understand the relationship between chemical composition and biological activity.
Check Digit Verification of cas no
The CAS Registry Mumber 175277-38-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 7 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 175277-38:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*7)+(2*3)+(1*8)=160
160 % 10 = 0
So 175277-38-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H6BrCl2NO2/c12-5-10(16)11-4-9(15-17-11)6-1-2-7(13)8(14)3-6/h1-4H,5H2
Xi:Irritant;
