175277-53-9 Usage
Uses
Used in Pharmaceutical Industry:
6-[(4-Chlorophenyl)thio]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde is used as a chemical intermediate for the development of new drugs due to its potential biological activities, including antimicrobial, antifungal, and antitumor properties.
Used in Research Applications:
In the field of scientific research, 6-[(4-Chlorophenyl)thio]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde serves as a valuable compound for studying its chemical properties and potential applications in drug design and synthesis. Further research is needed to fully understand its properties and explore its potential uses in various therapeutic areas.
Check Digit Verification of cas no
The CAS Registry Mumber 175277-53-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 7 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 175277-53:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*7)+(2*5)+(1*3)=159
159 % 10 = 9
So 175277-53-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H7ClN2OS2/c13-8-1-3-9(4-2-8)18-11-10(7-16)15-5-6-17-12(15)14-11/h1-7H
