175277-77-7 Usage
Uses
Used in Medicinal Chemistry:
3-[(2-OXO-2,3-DIHYDRO-1,3-BENZOXAZOL-3-YL)METHYL]BENZONITRILE is used as a chemical intermediate for the synthesis of various pharmaceuticals due to its unique structure and potential biological activity.
Used in Drug Development:
In the pharmaceutical industry, 3-[(2-OXO-2,3-DIHYDRO-1,3-BENZOXAZOL-3-YL)METHYL]BENZONITRILE is utilized as a key component in the development of new drugs, given its potential to contribute to the creation of novel therapeutic agents.
Used in Synthesis Research:
3-[(2-OXO-2,3-DIHYDRO-1,3-BENZOXAZOL-3-YL)METHYL]BENZONITRILE is employed as a subject of study in synthesis research, where researchers explore its properties, reactivity, and potential uses in the creation of new chemical entities.
Check Digit Verification of cas no
The CAS Registry Mumber 175277-77-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 7 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 175277-77:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*7)+(2*7)+(1*7)=167
167 % 10 = 7
So 175277-77-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H10N2O2/c16-9-11-4-3-5-12(8-11)10-17-13-6-1-2-7-14(13)19-15(17)18/h1-8H,10H2
