175277-97-1 Usage
Uses
Used in Pharmaceutical Industry:
3,5-Dichloro-2-iodotoluene is used as a key intermediate in the synthesis of various pharmaceutical compounds for its ability to facilitate the creation of complex molecular structures. Its unique halogenated aromatic nature allows for versatile chemical reactions, contributing to the development of new drugs with specific therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical sector, 3,5-Dichloro-2-iodotoluene serves as a crucial building block for the production of pesticides and other crop protection agents. Its chemical properties enable the formation of compounds that can effectively target and control pests, thereby enhancing crop yields and quality.
Used in Organic Chemical Synthesis:
3,5-Dichloro-2-iodotoluene is employed as a versatile intermediate in the synthesis of a wide range of organic chemicals. Its reactivity and stability make it an ideal candidate for the production of specialty chemicals used in various industries, such as dyes, plastics, and fragrances.
Used in Research and Development:
3,5-Dichloro-2-iodotoluene is utilized in research and development settings for the exploration of new chemical reactions and the discovery of novel compounds with potential applications in various fields. Its unique structure and properties provide a valuable platform for scientists to investigate and innovate in the realm of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 175277-97-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 7 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 175277-97:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*7)+(2*9)+(1*7)=171
171 % 10 = 1
So 175277-97-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H5Cl2I/c1-4-2-5(8)3-6(9)7(4)10/h2-3H,1H3
