175278-41-8 Usage
Description
3-(3-Nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid is a chemical compound with the molecular formula C14H15NO4. It is a derivative of acrylic acid, featuring a nitro group and a tetrahydro-1H-pyrrol-1-ylphenyl group. This unique structure and composition make it a versatile building block in the synthesis of various organic compounds, particularly in the pharmaceutical and chemical industries.
Uses
Used in Pharmaceutical Industry:
3-(3-Nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid is used as a key intermediate in the synthesis of new drugs. Its unique structure and properties allow for the development of innovative pharmaceutical compounds with potential therapeutic applications.
Used in Chemical Industry:
In the chemical industry, 3-(3-Nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid serves as a building block for the synthesis of various organic compounds. Its versatile chemical properties enable the creation of a wide range of products with diverse applications.
Used in Drug Development:
3-(3-Nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid is used as a starting material for the development of new drugs. Its unique structure and properties make it a promising candidate for the design and synthesis of novel pharmaceutical compounds with potential therapeutic benefits.
Used in Material Science:
3-(3-Nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid may also have potential applications in material science. Its unique structure and properties could be utilized in the development of new materials with specific characteristics, such as improved stability, reactivity, or other desirable properties.
Used in Biological Research:
Due to its potential biological activity, 3-(3-Nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid could be studied for its potential medicinal uses. Research into its biological properties may reveal new insights into its therapeutic potential and contribute to the development of novel treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 175278-41-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 8 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 175278-41:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*8)+(2*4)+(1*1)=158
158 % 10 = 8
So 175278-41-8 is a valid CAS Registry Number.
InChI:InChI=1/C13H14N2O4/c16-13(17)6-4-10-3-5-11(12(9-10)15(18)19)14-7-1-2-8-14/h3-6,9H,1-2,7-8H2,(H,16,17)/b6-4+