175278-45-2 Usage
Uses
Used in Pharmaceutical Industry:
3-[2-[(4-METHYLPHENYL)THIO]-5-NITROPHENYL]ACRYLIC ACID is used as an intermediate in the synthesis of pharmaceutical compounds for its ability to interact with biological molecules and proteins. Its unique structure allows for the development of drugs with specific targeting and therapeutic properties.
Used in Dye Industry:
In the dye industry, 3-[2-[(4-METHYLPHENYL)THIO]-5-NITROPHENYL]ACRYLIC ACID is used as a precursor for the production of various dyes. Its chemical structure contributes to the color and stability of the dyes, making it a valuable component in the formulation of different dye types.
Used in Polymer Industry:
3-[2-[(4-METHYLPHENYL)THIO]-5-NITROPHENYL]ACRYLIC ACID is utilized as a monomer in the polymer industry due to its reactivity in polymerization reactions. The resulting polymers can exhibit a range of properties, such as improved strength, flexibility, and resistance to environmental factors, depending on the specific application requirements.
Used in Organic Synthesis:
3-[2-[(4-METHYLPHENYL)THIO]-5-NITROPHENYL]ACRYLIC ACID is employed as a versatile building block in organic synthesis for the creation of complex organic molecules. Its unique functional groups allow for a variety of chemical reactions, enabling the synthesis of compounds with diverse applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 175278-45-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 8 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 175278-45:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*8)+(2*4)+(1*5)=162
162 % 10 = 2
So 175278-45-2 is a valid CAS Registry Number.
InChI:InChI=1/C16H13NO4S/c1-11-2-6-14(7-3-11)22-15-8-5-13(17(20)21)10-12(15)4-9-16(18)19/h2-10H,1H3,(H,18,19)/b9-4+