175278-50-9 Usage
Uses
Used in Organic Synthesis:
3-[4-[(4-METHYLPHENYL)THIO]-3-NITROPHENYL]ACRYLIC ACID is used as a building block in the synthesis of various organic materials. Its versatile structure allows it to be incorporated into a wide range of compounds, making it a valuable component in the development of new materials with specific properties.
Used in Pharmaceutical Research:
In the field of medicine, 3-[4-[(4-METHYLPHENYL)THIO]-3-NITROPHENYL]ACRYLIC ACID is studied for its potential pharmacological and biological activities. Its unique structure may contribute to the development of new drugs with novel mechanisms of action, offering potential therapeutic benefits for various medical conditions.
Used in Material Science:
3-[4-[(4-METHYLPHENYL)THIO]-3-NITROPHENYL]ACRYLIC ACID is also of interest in material science due to its potential applications in the development of new materials with specific properties. Its incorporation into various materials may lead to the creation of innovative products with improved performance characteristics.
Used in Chemical Research:
As a chemical compound with a unique structure, 3-[4-[(4-METHYLPHENYL)THIO]-3-NITROPHENYL]ACRYLIC ACID is a subject of interest for researchers in the field of chemistry. Its study may lead to a better understanding of the properties and behavior of similar compounds, contributing to the advancement of chemical knowledge and the development of new applications.
Check Digit Verification of cas no
The CAS Registry Mumber 175278-50-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 8 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 175278-50:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*8)+(2*5)+(1*0)=159
159 % 10 = 9
So 175278-50-9 is a valid CAS Registry Number.
InChI:InChI=1/C16H13NO4S/c1-11-2-6-13(7-3-11)22-15-8-4-12(5-9-16(18)19)10-14(15)17(20)21/h2-10H,1H3,(H,18,19)/b9-5+