175278-52-1 Usage
Description
3-[4-[(4-Chlorophenyl)thio]-3-nitrophenyl]acrylic acid is a chemical compound with the molecular formula C17H11ClNO4S. It is a derivative of acrylic acid and belongs to the class of nitrophenyl compounds. 3-[4-[(4-CHLOROPHENYL)THIO]-3-NITROPHENYL]ACRYLIC ACID features a 4-chlorophenylthio group and a 3-nitrophenyl group attached to the acrylic acid backbone, endowing it with unique chemical properties and structural characteristics. It is widely utilized in organic synthesis and pharmaceutical research as a key building block for the creation of various bioactive compounds.
Uses
Used in Pharmaceutical Research:
3-[4-[(4-Chlorophenyl)thio]-3-nitrophenyl]acrylic acid is used as a building block in pharmaceutical research for the synthesis of bioactive compounds. Its unique chemical structure allows for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Development:
In the agrochemical industry, 3-[4-[(4-Chlorophenyl)thio]-3-nitrophenyl]acrylic acid is used as a precursor in the synthesis of novel agrochemicals. Its chemical properties make it a valuable component in the development of pesticides and other agricultural chemicals.
Used in Materials Science:
3-[4-[(4-Chlorophenyl)thio]-3-nitrophenyl]acrylic acid is utilized in materials science for the development of new materials with specific properties. Its unique structure contributes to the creation of materials with potential applications in various industries, such as electronics, coatings, and adhesives.
Overall, 3-[4-[(4-Chlorophenyl)thio]-3-nitrophenyl]acrylic acid is a versatile chemical compound with a wide range of applications across different industries, including pharmaceuticals, agrochemicals, and materials science, due to its distinctive chemical structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 175278-52-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 8 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 175278-52:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*8)+(2*5)+(1*2)=161
161 % 10 = 1
So 175278-52-1 is a valid CAS Registry Number.
InChI:InChI=1/C15H10ClNO4S/c16-11-3-5-12(6-4-11)22-14-7-1-10(2-8-15(18)19)9-13(14)17(20)21/h1-9H,(H,18,19)/b8-2+
Xi:Irritant;
