175278-53-2 Usage
Uses
Used in Organic Synthesis:
4-[(2-FURYLMETHYL)THIO]-3-NITROBENZALDEHYDE is used as a building block in organic synthesis for the creation of various pharmaceuticals and biologically active molecules. Its unique structure allows for the formation of diverse chemical entities with potential therapeutic applications.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 4-[(2-FURYLMETHYL)THIO]-3-NITROBENZALDEHYDE is employed as a key intermediate in the synthesis of drugs with potential antifungal, antiviral, and anticancer properties. Its incorporation into drug molecules can enhance their efficacy and selectivity against various diseases.
Used in Antifungal Applications:
4-[(2-FURYLMETHYL)THIO]-3-NITROBENZALDEHYDE is used as an antifungal agent, leveraging its chemical properties to inhibit the growth of fungi and prevent infections. Its presence in antifungal formulations can contribute to the development of effective treatments for fungal diseases.
Used in Antiviral Applications:
4-[(2-FURYLMETHYL)THIO]-3-NITROBENZALDEHYDE is also utilized in antiviral applications, where it can potentially interfere with viral replication and reduce the spread of viral infections. Its antiviral properties make it a valuable component in the development of antiviral medications.
Used in Anticancer Applications:
4-[(2-FURYLMETHYL)THIO]-3-NITROBENZALDEHYDE is used as an anticancer agent, where its biological activities can target and inhibit the growth of cancer cells. Its incorporation into cancer therapeutics can lead to the development of novel treatments with improved efficacy and reduced side effects.
Used in Fragrance Industry:
Due to its powerful odor, 4-[(2-FURYLMETHYL)THIO]-3-NITROBENZALDEHYDE can be used in the fragrance industry as a component in creating unique scents and perfumes. Its distinct smell can contribute to the formulation of various fragrances used in personal care products and other applications.
Check Digit Verification of cas no
The CAS Registry Mumber 175278-53-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 8 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 175278-53:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*8)+(2*5)+(1*3)=162
162 % 10 = 2
So 175278-53-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H9NO4S/c14-7-9-3-4-12(11(6-9)13(15)16)18-8-10-2-1-5-17-10/h1-7H,8H2
