175278-64-5 Usage
Uses
Used in Chemical Synthesis:
4-BROMOBENZENESULFINIC ACID SODIUM SALT DIHYDRATE is used as a reagent for the preparation of unsymmetrical internal alkynes and vinyl sulfones. It is particularly useful in reactions involving alkynes, where it can be employed to facilitate the formation of these complex organic molecules. The compound is often used with palladium as a catalyst to enhance the reaction efficiency and yield.
In the Pharmaceutical Industry:
The compound may also find applications in the pharmaceutical industry, where it can be used in the synthesis of various drug molecules. Its ability to form unsymmetrical internal alkynes and vinyl sulfones makes it a valuable intermediate in the development of new pharmaceutical compounds.
In the Research and Development Sector:
4-BROMOBENZENESULFINIC ACID SODIUM SALT DIHYDRATE is used as a research chemical, allowing scientists to explore new reaction pathways and develop innovative synthetic methods. Its unique reactivity and the ability to form a variety of organic compounds make it an essential tool in the field of organic chemistry and materials science.
In the Agrochemical Industry:
The compound may also have potential applications in the agrochemical industry, where it could be used in the synthesis of new pesticides, herbicides, or other agricultural chemicals. Its versatility in forming complex organic molecules makes it a valuable asset in the development of novel agrochemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 175278-64-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 8 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 175278-64:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*8)+(2*6)+(1*4)=165
165 % 10 = 5
So 175278-64-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BrO2S.Na.2H2O/c7-5-1-3-6(4-2-5)10(8)9;;;/h1-4H,(H,8,9);;2*1H2/q;+1;;/p-1