175334-69-7 Usage
Uses
Used in Pharmaceutical Industry:
2-BROMO-1-[3-(2,4-DICHLOROPHENYL)ISOXAZOL-5-YL]ETHAN-1-ONE is used as a key intermediate in the synthesis of new drugs. Its unique structure allows for the development of compounds with specific therapeutic properties, making it a crucial component in medicinal chemistry for creating novel pharmaceutical agents.
Used in Agrochemical Industry:
In the agrochemical field, 2-BROMO-1-[3-(2,4-DICHLOROPHENYL)ISOXAZOL-5-YL]ETHAN-1-ONE is utilized as a precursor in the production of innovative pesticides. Its reactivity and structural features enable the creation of compounds with targeted pest control capabilities, contributing to more effective and environmentally friendly agricultural solutions.
Both of these applications highlight the compound's importance in research and development, where its unique attributes are leveraged to address specific challenges in medicine and agriculture.
Check Digit Verification of cas no
The CAS Registry Mumber 175334-69-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,3,3 and 4 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 175334-69:
(8*1)+(7*7)+(6*5)+(5*3)+(4*3)+(3*4)+(2*6)+(1*9)=147
147 % 10 = 7
So 175334-69-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H6BrCl2NO2/c12-5-10(16)11-4-9(15-17-11)7-2-1-6(13)3-8(7)14/h1-4H,5H2
Xi:Irritant;
