175334-72-2 Usage
General Description
ISOXAZOLE-5-CARBOTHIOAMIDE is a chemical compound with the molecular formula C4H4N2OS. It belongs to the class of organic compounds known as isoxazoles, which are five-membered heterocyclic compounds containing an oxygen atom and a nitrogen atom at two adjacent positions in the ring. ISOXAZOLE-5-CARBOTHIOAMIDE is a thiol derivative of isoxazole-5-carboxamide, and it can be synthesized through the reaction of isoniazid and carbon disulfide. It has been studied for its potential medicinal properties, including its antimicrobial and antitubercular activities. Additionally, ISOXAZOLE-5-CARBOTHIOAMIDE has been investigated for its potential as a building block for the synthesis of other compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 175334-72-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,3,3 and 4 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 175334-72:
(8*1)+(7*7)+(6*5)+(5*3)+(4*3)+(3*4)+(2*7)+(1*2)=142
142 % 10 = 2
So 175334-72-2 is a valid CAS Registry Number.
InChI:InChI=1/C4H4N2OS/c5-4(8)3-1-2-6-7-3/h1-2H,(H2,5,8)
