175334-72-2 Usage
Uses
Used in Pharmaceutical Industry:
ISOXAZOLE-5-CARBOTHIOAMIDE is used as a potential medicinal compound for its antimicrobial and antitubercular activities. It is being studied for its ability to combat various microbial infections and tuberculosis, offering a potential therapeutic option for these conditions.
Used in Chemical Synthesis:
ISOXAZOLE-5-CARBOTHIOAMIDE serves as a building block in the synthesis of other compounds. Its unique structure and properties make it a valuable component in the creation of new chemical entities for various applications, including pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Research and Development:
In the field of scientific research, ISOXAZOLE-5-CARBOTHIOAMIDE is utilized for studying its chemical properties, reactivity, and potential interactions with biological systems. This research can lead to a better understanding of its mechanisms of action and the development of new therapeutic agents based on its structure.
Check Digit Verification of cas no
The CAS Registry Mumber 175334-72-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,3,3 and 4 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 175334-72:
(8*1)+(7*7)+(6*5)+(5*3)+(4*3)+(3*4)+(2*7)+(1*2)=142
142 % 10 = 2
So 175334-72-2 is a valid CAS Registry Number.
InChI:InChI=1/C4H4N2OS/c5-4(8)3-1-2-6-7-3/h1-2H,(H2,5,8)
