175478-18-9 Usage
General Description
(2R,6R)-2-allyl-6-methyl-1,2,3,6-tetrahydropyridine is a chemical compound that belongs to the class of tetrahydropyridine derivatives. It is a chiral molecule, with two stereocenters at positions 2 and 6. (2R,6R)-2-ALLYL-6-METHYL-1,2,3,6-TETRAHYDROPYRIDINE has an allyl group attached to the second carbon atom and a methyl group attached to the sixth carbon atom. Tetrahydropyridines are known for their biological activity and have been studied for their potential use in pharmaceuticals. The specific properties and potential applications of (2R,6R)-2-allyl-6-methyl-1,2,3,6-tetrahydropyridine are not widely documented, so further research may be needed to fully understand its potential uses and effects.
Check Digit Verification of cas no
The CAS Registry Mumber 175478-18-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,4,7 and 8 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 175478-18:
(8*1)+(7*7)+(6*5)+(5*4)+(4*7)+(3*8)+(2*1)+(1*8)=169
169 % 10 = 9
So 175478-18-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H15N/c1-3-5-9-7-4-6-8(2)10-9/h3-4,6,8-10H,1,5,7H2,2H3/t8-,9-/m1/s1