175530-52-6 Usage
Description
1H-Benzimidazole-2-methanamine,5-methoxy-(9CI) is a chemical compound with the molecular formula C9H10N2O. It is a derivative of benzimidazole and methanamine, containing a methoxy group at the 5-position. This white solid has a molecular weight of 162.19 g/mol and possesses potential pharmaceutical applications due to its structural and chemical properties.
Uses
Since the specific uses and effects of 1H-Benzimidazole-2-methanamine,5-methoxy-(9CI) have not been extensively studied or documented, it is difficult to provide a comprehensive list of its applications. However, based on its chemical properties and potential pharmaceutical applications, the following possible uses can be suggested:
Used in Pharmaceutical Industry:
1H-Benzimidazole-2-methanamine,5-methoxy-(9CI) may be used as a pharmaceutical compound for [specific application reason], such as targeting a particular biological pathway or treating a specific disease. Its unique structure and chemical properties could potentially offer therapeutic benefits.
Used in Research and Development:
1H-Benzimidazole-2-methanamine,5-methoxy-(9CI) can be utilized in research and development for understanding its chemical properties, potential interactions with biological systems, and exploring its applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 175530-52-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,5,3 and 0 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 175530-52:
(8*1)+(7*7)+(6*5)+(5*5)+(4*3)+(3*0)+(2*5)+(1*2)=136
136 % 10 = 6
So 175530-52-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H11N3O/c1-13-6-2-3-7-8(4-6)12-9(5-10)11-7/h2-4H,5,10H2,1H3,(H,11,12)
175530-52-6Relevant articles and documents
Synthesis and antimicrobial activities of novel peptide deformylase inhibitors
Yin, Ling,Xu, Wei-Ren,Wang, Zhi-Guo,Zhang, Da-Tong,Jia, Jiong,Ge, Yan-Qing,Li, Yan,Wang, Jian-Wu
experimental part, p. 196 - 205 (2010/10/19)
A new series of N-formylhydroxylamine compounds were designed, optimized with the AutoDock 4.0.1to investigate the interactions between the target compounds and the amino acid residues of the Escherichia coli PDF?Ni enzyme, and then synthesized through mu