17586-89-9 Usage
Uses
Used in Dye Production:
2-[(2,4-Dinitrophenyl)thio]-benzothiazole is used as a chemical intermediate for the production of dyes. Its unique structure, which includes nitro groups and a benzothiazole moiety, contributes to the color properties of the dyes, making it a valuable component in this industry.
Used in Pharmaceutical Industry:
2-[(2,4-Dinitrophenyl)thio]-benzothiazole is used as a building block in the synthesis of pharmaceutical compounds. Its presence in the structure of certain drugs can impart specific therapeutic properties, such as antimicrobial or anti-inflammatory effects, making it a valuable asset in the development of new medications.
Used in Chemical Compounds Production:
2-[(2,4-Dinitrophenyl)thio]-benzothiazole is used as a key component in the production of other chemical compounds. Its versatile structure allows it to be incorporated into a wide range of molecules, making it a useful tool in the synthesis of various chemicals for different applications.
Check Digit Verification of cas no
The CAS Registry Mumber 17586-89-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,5,8 and 6 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 17586-89:
(7*1)+(6*7)+(5*5)+(4*8)+(3*6)+(2*8)+(1*9)=149
149 % 10 = 9
So 17586-89-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H7N3O4S2/c17-15(18)8-5-6-12(10(7-8)16(19)20)22-13-14-9-3-1-2-4-11(9)21-13/h1-7H
