176-57-8 Usage
Explanation
Different sources of media describe the Explanation of 176-57-8 differently. You can refer to the following data:
1. The molecular formula represents the number of atoms of each element present in a molecule of the compound.
2. Tellurium-containing heterocyclic compound
2. The compound contains a tellurium atom and is part of a class of compounds with a ring structure containing more than one type of atom.
3. Spirocyclic structure
3. The compound has a central tellurium atom bonded to four oxygen atoms, forming a four-membered ring, with additional carbon atoms connected to form a nine-membered spiro ring system.
4. Central tellurium atom
4. The tellurium atom is the central atom in the compound, bonded to four oxygen atoms.
5. Four-membered ring
5. The ring formed by the central tellurium atom and the four oxygen atoms.
6. Nine-membered spiro ring system
6. The additional carbon atoms connected to the four-membered ring form a nine-membered spiro ring system.
7. Member of organotellurium compounds
7. The compound belongs to a class of compounds that contain tellurium and are known for their diverse biological and medicinal properties.
8. Diverse biological and medicinal properties
8. Organotellurium compounds, including 1,4,6,9-tetraoxa-5$l^4-telluraspiro[4.4]nonane, have potential applications in various fields due to their unique properties.
9. Unique chemical reactivity
9. The presence of the tellurium atom in the compound provides unique chemical reactivity, which can be exploited in various applications.
10. Potential application in organic synthesis and material science
10. Due to its unique properties and reactivity, 1,4,6,9-tetraoxa-5$l^4-telluraspiro[4.4]nonane can be used in the development of new organic compounds and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 176-57-8 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,7 and 6 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 176-57:
(5*1)+(4*7)+(3*6)+(2*5)+(1*7)=68
68 % 10 = 8
So 176-57-8 is a valid CAS Registry Number.
InChI:InChI=1/C4H8O4Te/c1-2-6-9(5-1)7-3-4-8-9/h1-4H2
176-57-8Relevant articles and documents
Chalcogenide esters as reactive intermediates in selenium and tellurium purifications
Badesha, Santokh S.,Monczka, Paul,Smith, Steven D.
, p. 2199 - 2202 (2007/10/02)
This paper describes a novel application of chalcogenide esters to purify selenium and tellurium to the 99.999percent purity level.The calcogenide esters were prepared froma variety of source materials which include: crude selenium and tellurium and commercial grade selenium dioxide, tellurium dioxide, and selenous acid.Crude selenium and tellurium were first converted to their respective oxides by treatment with concentrated nitric acid.The oxides were condensed with alcohols or diols to obtain the corresponding esters which, on reduction with hydrazine in organic media, provided high purity elemental selenium and tellurium.
