176-67-0 Usage
Uses
Used in Pharmaceutical Industry:
2,8-Diazaspiro[4.5]decane is used as a structural scaffold for drug development due to its unique spiro-fused ring system and ability to bind multiple targets. Its polarity, basicity, rigidity, and hydrogen bonding capabilities make it an ideal candidate for creating lead compounds, which are crucial in the drug discovery process.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 2,8-Diazaspiro[4.5]decane is utilized as a key component in the synthesis of various bioactive molecules. Its unique structural features and ability to form hydrogen bonds contribute to the development of novel therapeutic agents with improved binding affinities and selectivity towards target proteins or enzymes.
Used in Drug Design and Optimization:
2,8-Diazaspiro[4.5]decane serves as a valuable building block in the design and optimization of drug candidates. Its rigid and polar nature allows for the fine-tuning of molecular interactions, leading to the development of more potent and selective drugs with reduced side effects.
Used in Organic Synthesis:
In organic synthesis, 2,8-Diazaspiro[4.5]decane is employed as a versatile intermediate for the synthesis of a wide range of organic compounds. Its unique spiro-fused ring system and functional groups enable the formation of diverse molecular architectures, which can be further modified to achieve desired properties and reactivities.
Used in Chemical Research:
2,8-Diazaspiro[4.5]decane is also utilized in chemical research to explore novel reaction mechanisms, catalysts, and synthetic strategies. Its unique structural features provide a platform for investigating new chemical transformations and understanding the underlying principles governing their selectivity and efficiency.
Check Digit Verification of cas no
The CAS Registry Mumber 176-67-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,7 and 6 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 176-67:
(5*1)+(4*7)+(3*6)+(2*6)+(1*7)=70
70 % 10 = 0
So 176-67-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H16N2/c1-4-9-5-2-8(1)3-6-10-7-8/h9-10H,1-7H2
