17627-78-0 Usage
General Description
"(9S)-6,7,8,9-Tetrahydro-4-methoxy-8,9-dimethyl-1,3-dioxolo[4,5-h]isoquinoline" is a specific chemical compound. Its structure is made up of a unique arrangement of carbon, hydrogen, and oxygen atoms, forming a complex cyclic structure. (9S)-6,7,8,9-Tetrahydro-4-methoxy-8,9-dimethyl-1,3-dioxolo[4,5-h]isoquinoline belongs to the class of organic compounds known as isoquinolines and derivatives, which consist of compounds containing the isoquinoline moiety, a polycyclic aromatic compound made up of two fused rings, a benzene ring and a pyridine ring. In specific, it is built with an isoquinoline backbone, where two additional rings are fused to the benzene part, along with the functional groups such as methoxy and methyl appendages. However, detailed information about its physical and chemical properties, potential applications or uses, and safety data appear to be lacking in the current scientific literature.
Check Digit Verification of cas no
The CAS Registry Mumber 17627-78-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,6,2 and 7 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 17627-78:
(7*1)+(6*7)+(5*6)+(4*2)+(3*7)+(2*7)+(1*8)=130
130 % 10 = 0
So 17627-78-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H17NO3/c1-8-11-9(4-5-14(8)2)6-10(15-3)12-13(11)17-7-16-12/h6,8H,4-5,7H2,1-3H3/t8-/m0/s1
