176853-91-1

Usage

Uses

Used in Pharmaceutical Industry:
2-NITRO-9H-PYRIDO[2,3-B]INDOLE is used as a metabolite in the pharmaceutical industry for its potential role in the development of new drugs and therapies. Its unique chemical structure may offer novel interactions with biological targets, leading to the discovery of new treatments for various diseases.
Used in Chemical Research:
In the field of chemical research, 2-NITRO-9H-PYRIDO[2,3-B]INDOLE serves as a valuable compound for studying the properties and reactivity of heterocyclic amines. Its synthesis and modification can provide insights into the development of new chemical processes and applications.
Used in Environmental Monitoring:
2-NITRO-9H-PYRIDO[2,3-B]INDOLE can be used as a marker compound in environmental monitoring to detect the presence of heterocyclic amines in various samples, such as air, water, and soil. This can help in assessing the exposure risks and implementing appropriate mitigation measures.
Used in Analytical Chemistry:
As a reference compound, 2-NITRO-9H-PYRIDO[2,3-B]INDOLE can be employed in analytical chemistry for the calibration of instruments and the development of new analytical methods. Its unique properties can contribute to the improvement of detection and quantification techniques in various applications.

InChI:InChI=1/C11H7N3O2/c15-14(16)10-6-5-8-7-3-1-2-4-9(7)12-11(8)13-10/h1-6H,(H,12,13)

Upstream product

• 26148-68-5 2-amino-9H-pyrido[2,3-b]indole 

Relevant academic research and scientific papers

In vitro metabolism of two heterocyclic amines, 2-amino-9H-pyrido[2,3-b]indole (AαC) and 2-amino-3-methyl-9H-pyrido[2,3-b]indole (MeAαC) in human and rat hepatic microsomes

2-Amino-9H-pyrido[2,3-b]indole (AαC) and 2-amino-3-methyl-9H-pyrido[2,3-b]indole (MeAαC) are two mutagenic and carcinogenic heterocyclic amines formed during ordinary cooking. In this study, we have investigated the in vitro metabolism of tritium-labelled AαC and MeAαC in hepatic microsomes from human pools, rats induced with polychlorinated biphenyl (PCB) (Aroclor 1254) and control rats. The microsomes were incubated with AαC and MeAαC and the detoxified and activated metabolites of AαC and MeAαC were separated and characterised by HPLC-MS. AαC is metabolised to two major and three minor detoxified metabolites, while MeAαC is metabolised to three major and one minor detoxified metabolites. Some AαC and MeAαC are activated by oxidation to the reactive metabolites N2-OH-AαC and N2-OH-MeAαC, respectively. These reactive N2-OH-metabolites react partially in the incubation system with formation of protein adducts, dimers and the parent compound by reduction of the N2-OH-metabolites. The distribution between the detoxified and activated metabolites in the different types of hepatic microsomes showed same pattern for both AαC and MeAαC. In PCB-induced rat microsomes, the major part of the metabolites are detoxified, only a little amount is activated. In control rat microsomes there is a fifty-fifty distribution between detoxification and activation, while the major part of the metabolites from the human microsomes are activated and reacts to form dimers and protein adducts. These data show that, in human hepatic microsomes compared to rat hepatic microsomes, a major part of AαC and MeAαC are metabolically activated to the reactive N2-OH-AαC and N2-OH-MeAαC.