177735-28-3 Usage
Uses
Used in Organic Synthesis:
2,5-Dichlorothiophene-3-boronic acid is used as a building block in organic synthesis for its ability to participate in various organic reactions. Its boronic acid functional group allows it to undergo Suzuki coupling and cross-coupling reactions, facilitating the synthesis of a wide range of organic compounds.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 2,5-Dichlorothiophene-3-boronic acid is utilized as a versatile intermediate for the development of pharmaceuticals. Its unique structure and functional groups enable the creation of novel drug candidates with potential therapeutic applications.
Used in Agrochemical Development:
2,5-Dichlorothiophene-3-boronic acid is also employed in the development of agrochemicals, where its reactivity and properties can be tailored for specific applications in agriculture, such as the synthesis of new pesticides or herbicides.
Used in Chemical Modification:
The chlorine substituents in 2,5-Dichlorothiophene-3-boronic acid can be further functionalized, allowing for the customization of its reactivity and properties to suit specific applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 177735-28-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,7,7,3 and 5 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 177735-28:
(8*1)+(7*7)+(6*7)+(5*7)+(4*3)+(3*5)+(2*2)+(1*8)=173
173 % 10 = 3
So 177735-28-3 is a valid CAS Registry Number.
InChI:InChI=1/C4H3BCl2O2S/c6-3-1-2(5(8)9)4(7)10-3/h1,8-9H
