177735-28-3 Usage
General Description
2,5-Dichlorothiophene-3-boronic acid is a chemical compound with the molecular formula C4H3BCl2O2S. It is a boronic acid derivative of thiophene, containing two chlorine atoms attached to the thiophene ring. 2,5-Dichlorothiophene-3-boronic acid is commonly used as a building block in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals and agrochemicals. Its boronic acid functional group allows it to participate in various organic reactions, such as Suzuki coupling and cross-coupling reactions, making it a versatile intermediate for the synthesis of a wide range of organic compounds. Additionally, its chlorine substituents can be further functionalized to tailor its reactivity and properties for specific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 177735-28-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,7,7,3 and 5 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 177735-28:
(8*1)+(7*7)+(6*7)+(5*7)+(4*3)+(3*5)+(2*2)+(1*8)=173
173 % 10 = 3
So 177735-28-3 is a valid CAS Registry Number.
InChI:InChI=1/C4H3BCl2O2S/c6-3-1-2(5(8)9)4(7)10-3/h1,8-9H
