177839-85-9 Usage
Uses
Used in Pharmaceutical Formulations:
(R)-3-AMINO-4-(4-METHYLPHENYL)BUTANOIC ACID HYDROCHLORIDE is used as a pharmaceutical ingredient for its high solubility in water, which aids in the development of various drug formulations. Its balanced combination of functional groups contributes to the stability and efficacy of the formulations.
Used in Biochemical Research and Analysis:
In the field of biochemical research, (R)-3-AMINO-4-(4-METHYLPHENYL)BUTANOIC ACID HYDROCHLORIDE serves as a reagent or buffer, facilitating various analytical processes. Its chemical properties make it suitable for use in assays and other laboratory techniques that require precise control over chemical conditions.
Used in Medicinal Applications:
(R)-3-AMINO-4-(4-METHYLPHENYL)BUTANOIC ACID HYDROCHLORIDE is utilized as a potential treatment for certain medical conditions due to its specific properties and structure. Its role in medicinal applications is attributed to its ability to interact with biological systems, offering therapeutic benefits.
Used in Drug Development:
In the pharmaceutical industry, (R)-3-AMINO-4-(4-METHYLPHENYL)BUTANOIC ACID HYDROCHLORIDE is employed in the development of new drugs. Its unique chemical characteristics make it a valuable component in the creation of innovative medications designed to address specific health issues.
Check Digit Verification of cas no
The CAS Registry Mumber 177839-85-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,7,8,3 and 9 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 177839-85:
(8*1)+(7*7)+(6*7)+(5*8)+(4*3)+(3*9)+(2*8)+(1*5)=199
199 % 10 = 9
So 177839-85-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H15NO2.ClH/c1-8-2-4-9(5-3-8)6-10(12)7-11(13)14;/h2-5,10H,6-7,12H2,1H3,(H,13,14);1H/t10-;/m1./s1
