177985-32-9 Usage
Uses
Used in Pharmaceutical Industry:
2-Chloro-4-fluorophenylacetic acid is used as a pharmaceutical intermediate for the production of various medications. Its unique chemical structure allows it to be a key component in the synthesis of drugs that target specific medical conditions.
As a pharmaceutical intermediate, 2-Chloro-4-fluorophenylacetic acid plays a vital role in the development of new drugs, contributing to the advancement of medical treatments and therapies. Its application in the pharmaceutical industry is primarily due to its ability to be incorporated into the molecular structure of various medications, enhancing their effectiveness and targeting specific health issues.
Check Digit Verification of cas no
The CAS Registry Mumber 177985-32-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,7,9,8 and 5 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 177985-32:
(8*1)+(7*7)+(6*7)+(5*9)+(4*8)+(3*5)+(2*3)+(1*2)=199
199 % 10 = 9
So 177985-32-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClFO2/c9-7-4-6(10)2-1-5(7)3-8(11)12/h1-2,4H,3H2,(H,11,12)/p-1
