177985-33-0 Usage
Uses
Used in Pharmaceutical Industry:
2-CHLORO-5-FLUOROPHENYLACETIC ACID is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique chemical structure allows for the development of new drugs with improved therapeutic properties and reduced side effects. It plays a crucial role in the production of medications for the treatment of various diseases and conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 2-CHLORO-5-FLUOROPHENYLACETIC ACID is utilized as a building block for the creation of novel agrochemicals. Its incorporation into the molecular structure of these compounds can enhance their effectiveness in controlling pests, diseases, and weeds, thereby improving crop yields and ensuring food security.
Used in Organic Synthesis:
2-CHLORO-5-FLUOROPHENYLACETIC ACID is also employed as a versatile intermediate in organic synthesis. Its reactivity and functional groups make it suitable for the preparation of a wide range of organic compounds, including dyes, polymers, and other specialty chemicals. This versatility allows researchers and chemists to explore new applications and develop innovative products across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 177985-33-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,7,9,8 and 5 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 177985-33:
(8*1)+(7*7)+(6*7)+(5*9)+(4*8)+(3*5)+(2*3)+(1*3)=200
200 % 10 = 0
So 177985-33-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClFO2/c9-7-2-1-6(10)3-5(7)4-8(11)12/h1-3H,4H2,(H,11,12)
