1780-28-5 Usage
Uses
Used in Pharmaceutical Industry:
4,5,6-trichloro-2-methylpyrimidine serves as a crucial building block in the synthesis of various pharmaceuticals and organic compounds. Its unique structure and reactivity make it a valuable component in the development of new drugs and therapeutic agents.
Used in Organic Synthesis:
In the field of organic synthesis, 4,5,6-trichloro-2-methylpyrimidine is utilized as a key intermediate for the preparation of a wide range of organic compounds. Its versatility and reactivity contribute to the synthesis of various chemical products, including agrochemicals, dyes, and other specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 1780-28-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,7,8 and 0 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 1780-28:
(6*1)+(5*7)+(4*8)+(3*0)+(2*2)+(1*8)=85
85 % 10 = 5
So 1780-28-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H3Cl3N2/c1-2-9-4(7)3(6)5(8)10-2/h1H3
