17824-82-7 Usage
Uses
Used in Pesticide and Insecticide Synthesis:
2,4,5,6-Tetrachloro-nicotinonitrile is used as a chemical intermediate in the synthesis of various pesticides and insecticides. Its role in these applications is attributed to its organochlorine nature and the presence of the nicotinonitrile core, which can be further modified to create effective pest control agents.
Used in Chemical Research:
In the field of chemical research, 2,4,5,6-tetrachloro-nicotinonitrile serves as a valuable compound for studying the properties and reactions of organochlorine compounds and their derivatives. Its unique structure allows researchers to explore its reactivity, stability, and potential applications in various chemical processes.
Used in Environmental Studies:
2,4,5,6-Tetrachloro-nicotinonitrile is used in environmental studies to assess its potential impact on ecosystems and wildlife. Given its non-toxicity to certain organisms, it can be studied to understand its behavior in the environment, its degradation pathways, and its potential effects on non-target species.
Used in Pharmaceutical Development:
Although not explicitly mentioned in the provided materials, the structural similarity of 2,4,5,6-tetrachloro-nicotinonitrile to nicotine suggests that it may have potential applications in the development of pharmaceuticals, particularly those targeting the nicotinic acetylcholine receptor. Further research would be required to explore this possibility and assess its safety and efficacy in such applications.
Check Digit Verification of cas no
The CAS Registry Mumber 17824-82-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,8,2 and 4 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 17824-82:
(7*1)+(6*7)+(5*8)+(4*2)+(3*4)+(2*8)+(1*2)=127
127 % 10 = 7
So 17824-82-7 is a valid CAS Registry Number.
InChI:InChI=1/C6Cl4N2/c7-3-2(1-11)5(9)12-6(10)4(3)8
