1785-11-1 Usage
Uses
Used in Organic Synthesis:
4-Amino-2,7-dibromo-9H-fluoren-9-one is utilized as a reagent in organic synthesis, contributing to the creation of a wide range of chemical products. Its unique structure allows it to participate in various chemical reactions, making it a valuable component in the synthesis of complex organic molecules.
Used as a Precursor in Functionalized Fluorenone Derivatives:
4-AMino-2,7-dibroMo-9H-fluoren-9-one serves as a precursor for the preparation of various functionalized fluorenone derivatives. Its ability to be modified and incorporated into other molecules makes it instrumental in the development of new materials with specific properties.
Used in Materials Science:
4-Amino-2,7-dibromo-9H-fluoren-9-one has been studied for potential applications in materials science. Its unique chemical and physical properties make it a candidate for use in the development of advanced materials with tailored characteristics for specific applications.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 4-Amino-2,7-dibromo-9H-fluoren-9-one is explored for its potential use in drug discovery and development. Its chemical structure may offer new avenues for the creation of therapeutic agents, contributing to the advancement of medicine and healthcare.
Check Digit Verification of cas no
The CAS Registry Mumber 1785-11-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,7,8 and 5 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 1785-11:
(6*1)+(5*7)+(4*8)+(3*5)+(2*1)+(1*1)=91
91 % 10 = 1
So 1785-11-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H7Br2NO/c14-6-1-2-8-9(3-6)13(17)10-4-7(15)5-11(16)12(8)10/h1-5H,16H2
