178685-06-8 Usage
Description
4-(Iodomethyl)-9H-xanthene is a chemical compound with the molecular formula C14H11IO, consisting of a xanthene core with an iodomethyl group attached to one of its carbon atoms. It is known for its photoluminescent properties, making it valuable in various applications.
Uses
Used in Organic Synthesis:
4-(Iodomethyl)-9H-xanthene is used as a fluorescent dye and as a building block for the production of various pharmaceuticals and agrochemicals. Its unique structure and properties make it a versatile compound in the field of organic synthesis.
Used in Fluorescent Labels for Biomolecules and Materials:
Leveraging its photoluminescent properties, 4-(Iodomethyl)-9H-xanthene is used in the development of fluorescent labels for biomolecules and materials. This allows for the tracking and visualization of these molecules in various research and diagnostic applications.
Used as a Fluorescent Tracer in Biological and Environmental Studies:
4-(Iodomethyl)-9H-xanthene is utilized as a fluorescent tracer in biological and environmental studies. Its ability to emit light upon exposure to specific wavelengths makes it a valuable tool for tracking and analyzing various processes and substances.
Used in Manufacturing of OLED Materials:
4-(IODOMETHYL)-9H-XANTHENE is also used in the manufacturing of OLED (organic light-emitting diode) materials. Its photoluminescent properties contribute to the development of advanced display and lighting technologies.
Used in Photodynamic Therapy for Cancer Treatment:
4-(Iodomethyl)-9H-xanthene has potential applications in the field of photodynamic therapy for cancer treatment. Its ability to absorb light and generate reactive oxygen species can be harnessed to target and destroy cancer cells selectively.
Check Digit Verification of cas no
The CAS Registry Mumber 178685-06-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,8,6,8 and 5 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 178685-06:
(8*1)+(7*7)+(6*8)+(5*6)+(4*8)+(3*5)+(2*0)+(1*6)=188
188 % 10 = 8
So 178685-06-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H11IO/c15-9-12-6-3-5-11-8-10-4-1-2-7-13(10)16-14(11)12/h1-7H,8-9H2