17869-11-3 Usage
General Description
1-amino-4-hydroxy-2-[2-(2-methoxyethoxy)ethoxy]anthraquinone is a chemical compound with the molecular formula C21H21NO6. It is a derivative of anthraquinone and is commonly used as a dye intermediate in the production of various dyes and pigments. The compound contains an amino group, a hydroxy group, and multiple ether linkages, making it a versatile building block for synthesizing a wide range of organic compounds. It is also known for its photophysical properties, making it useful in the development of optical materials and sensors. Additionally, 1-amino-4-hydroxy-2-[2-(2-methoxyethoxy)ethoxy]anthraquinone has potential applications in the field of biomedicine, as it has shown promising results in various biological assays.
Check Digit Verification of cas no
The CAS Registry Mumber 17869-11-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,8,6 and 9 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 17869-11:
(7*1)+(6*7)+(5*8)+(4*6)+(3*9)+(2*1)+(1*1)=143
143 % 10 = 3
So 17869-11-3 is a valid CAS Registry Number.
InChI:InChI=1/C19H19NO6/c1-24-6-7-25-8-9-26-14-10-13(21)15-16(17(14)20)19(23)12-5-3-2-4-11(12)18(15)22/h2-5,10,21H,6-9,20H2,1H3