178748-22-6 Usage
Uses
Used in Chemical Research:
4-Chloro-1,2-benzisoxazol-3(2H)-one is used as a research material for its unique chemical properties, allowing scientists to explore its potential applications and interactions with other compounds. Its light and moisture sensitivity also provide opportunities for studying its behavior under various conditions.
Used in Organic Synthesis:
In the field of organic synthesis, 4-Chloro-1,2-benzisoxazol-3(2H)-one is employed as a key intermediate. Its presence in the synthesis process can lead to the creation of a wide range of complex chemical compounds, making it an essential component in the development of new materials and substances.
Used in Pharmaceutical Industry:
4-Chloro-1,2-benzisoxazol-3(2H)-one is used as a precursor in the production of pharmaceutical compounds. Its role in the synthesis of drug molecules can contribute to the development of new medications and therapies, potentially improving the treatment of various diseases and conditions.
Used in Material Science:
In material science, 4-Chloro-1,2-benzisoxazol-3(2H)-one is utilized as a component in the development of new materials. Its chemical properties can influence the characteristics of the final product, such as its stability, reactivity, or other physical properties, making it a valuable asset in the creation of innovative materials for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 178748-22-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,8,7,4 and 8 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 178748-22:
(8*1)+(7*7)+(6*8)+(5*7)+(4*4)+(3*8)+(2*2)+(1*2)=186
186 % 10 = 6
So 178748-22-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H4ClNO2/c8-4-2-1-3-5-6(4)7(10)9-11-5/h1-3H,(H,9,10)
