17890-77-6 Usage
Uses
Used in Medicinal Chemistry:
3-amino-6-bromopyrazine-2-carboxamide is used as a key intermediate for the synthesis of various drugs. Its chemical structure, which includes an amino group, a carboxamide group, and a bromine atom, makes it a valuable building block in the creation of complex molecules with potential therapeutic applications.
Used in Pharmaceutical Industry:
3-amino-6-bromopyrazine-2-carboxamide is used as a versatile intermediate for the development of new pharmaceutical compounds. Its ability to participate in various chemical reactions allows for the production of a wide range of drug candidates with different therapeutic properties.
Used in Chemical Reactions:
3-amino-6-bromopyrazine-2-carboxamide is used as a reactant in various chemical reactions to create desired end products. Its unique structure, with the amino, carboxamide, and bromine substituents, enables it to undergo a range of reactions, making it a valuable component in the synthesis of complex molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 17890-77-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,8,9 and 0 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 17890-77:
(7*1)+(6*7)+(5*8)+(4*9)+(3*0)+(2*7)+(1*7)=146
146 % 10 = 6
So 17890-77-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H5BrN4O/c6-2-1-9-4(7)3(10-2)5(8)11/h1H,(H2,7,9)(H2,8,11)
