179028-65-0 Usage
Uses
Used in Organic Synthesis:
2-Cyano-5-methoxybenzoic acid is used as a building block in organic synthesis for the creation of various pharmaceuticals and agrochemicals. Its presence of a cyano and methoxy group allows for a wide range of chemical reactions, making it a valuable intermediate in the synthesis of complex organic molecules.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 2-Cyano-5-methoxybenzoic acid is utilized as a key component in the development of new drugs. Its reported anti-inflammatory and anti-cancer properties make it a promising candidate for the treatment of various diseases. Researchers are actively exploring its potential as a therapeutic agent in drug discovery and development.
Used in Pharmaceutical Industry:
2-Cyano-5-methoxybenzoic acid is used as an active pharmaceutical ingredient (API) in the development of new medications. Its unique chemical structure and functional groups enable the design of novel drug molecules with improved therapeutic effects and reduced side effects. 2-Cyano-5-methoxybenzoic acid's potential in treating inflammation and cancer makes it particularly valuable in the pharmaceutical industry.
Used in Agrochemical Industry:
2-Cyano-5-methoxybenzoic acid also finds applications in the agrochemical industry, where it is used as a building block for the synthesis of various agrochemicals, such as pesticides and herbicides. Its ability to form stable and bioactive compounds makes it a valuable component in the development of effective and environmentally friendly agrochemicals.
Used in Dyes and Pigments Production:
Due to its aromatic structure and functional groups, 2-Cyano-5-methoxybenzoic acid may have applications in the production of dyes and pigments. Its ability to form stable and colorful compounds makes it a potential candidate for use in various industries, such as textiles, plastics, and printing inks.
Check Digit Verification of cas no
The CAS Registry Mumber 179028-65-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,9,0,2 and 8 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 179028-65:
(8*1)+(7*7)+(6*9)+(5*0)+(4*2)+(3*8)+(2*6)+(1*5)=160
160 % 10 = 0
So 179028-65-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H7NO3/c1-13-7-3-2-6(5-10)8(4-7)9(11)12/h2-4H,1H3,(H,11,12)
