179747-84-3 Usage
Uses
Used in Pharmaceutical Industry:
(R)-3-N-CBZ-AMINO-SUCCINIMIDE is used as a key intermediate for the synthesis of various pharmaceutical compounds. Its unique structure and reactivity make it a valuable component in the development of new drugs and therapeutic agents.
Used in Organic Chemistry Reactions:
(R)-3-N-CBZ-AMINO-SUCCINIMIDE is used as a reagent in organic chemistry reactions, facilitating the formation of desired products and enhancing the efficiency of synthetic processes. Its versatility and stability contribute to its widespread use in research and industrial applications.
Used in Bioactive Molecule Preparation:
(R)-3-N-CBZ-AMINO-SUCCINIMIDE is used as a precursor in the preparation of bioactive molecules, which have potential applications in medicine, agriculture, and other fields. Its ability to be modified and functionalized allows for the creation of diverse and effective compounds with targeted biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 179747-84-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,9,7,4 and 7 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 179747-84:
(8*1)+(7*7)+(6*9)+(5*7)+(4*4)+(3*7)+(2*8)+(1*4)=203
203 % 10 = 3
So 179747-84-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H12N2O4/c15-10-6-9(11(16)14-10)13-12(17)18-7-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,17)(H,14,15,16)/t9-/m1/s1
