179816-26-3 Usage
Uses
Used in Pharmaceutical Industry:
Phenol, 2-fluoro-3-nitro(9CI) is used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique chemical structure allows for the development of new drugs with potential therapeutic applications.
Used in Pesticide Industry:
In the pesticide industry, Phenol, 2-fluoro-3-nitro(9CI) is used as a precursor in the production of various pesticides. Its chemical properties contribute to the effectiveness of these pesticides in controlling pests and protecting crops.
Used in Dye Industry:
Phenol, 2-fluoro-3-nitro(9CI) is utilized in the dye industry for the production of various dyes. Its unique chemical structure allows for the creation of dyes with specific color properties and stability.
Used in Research and Development:
Phenol, 2-fluoro-3-nitro(9CI) has potential applications in research and development in both the agricultural and pharmaceutical industries. Its unique chemical properties make it a valuable compound for exploring new chemical reactions and developing innovative products.
It is important to handle Phenol, 2-fluoro-3-nitro(9CI) with care, as it may have hazardous effects on human health and the environment. Proper safety measures should be taken during its production, use, and disposal to minimize any potential risks.
Check Digit Verification of cas no
The CAS Registry Mumber 179816-26-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,9,8,1 and 6 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 179816-26:
(8*1)+(7*7)+(6*9)+(5*8)+(4*1)+(3*6)+(2*2)+(1*6)=183
183 % 10 = 3
So 179816-26-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H4FNO3/c7-6-4(8(10)11)2-1-3-5(6)9/h1-3,9H
179816-26-3Relevant academic research and scientific papers
Method for producing an optically active 1-substituted 2-propanol
-
, (2008/06/13)
A method for producing an optically active 1-substituted 2-propanol of the following formula 1, which comprises reacting a hydroxy aromatic compound of the following formula 2 with an optically active propylene oxide in the presence of a catalyst:AOH??Formula 2CH3C*H(OH)CH2OA??Formula 1wherein A is a univalent aromatic group, and C* is an asymmetric carbon atom.
