180530-13-6 Usage
Description
3-(5-BROMO-2-THIENYL)-5-METHYL-1,2,4-OXADIAZOLE is a chemical compound characterized by its molecular formula C8H6BrN3OS. It features a 1,2,4-oxadiazole ring fused with a 5-bromo-2-thienyl group and a 5-methyl group. 3-(5-BROMO-2-THIENYL)-5-METHYL-1,2,4-OXADIAZOLE is recognized for its potential biological activity and serves as a versatile building block in pharmaceutical research, making it a significant target for drug development due to its unique properties.
Uses
Used in Pharmaceutical Research:
3-(5-BROMO-2-THIENYL)-5-METHYL-1,2,4-OXADIAZOLE is used as a key intermediate in the synthesis of various pharmaceutical compounds for its potential biological activity.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 3-(5-bromo-2-thienyl)-5-methyl-1,2,4-oxadiazole derivatives are utilized for their demonstrated antibacterial, antifungal, and anticancer activities, making this compound a valuable asset for the development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 180530-13-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,0,5,3 and 0 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 180530-13:
(8*1)+(7*8)+(6*0)+(5*5)+(4*3)+(3*0)+(2*1)+(1*3)=106
106 % 10 = 6
So 180530-13-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H5BrN2OS/c1-4-9-7(10-11-4)5-2-3-6(8)12-5/h2-3H,1H3