180608-37-1 Usage
Uses
Used in Organic Synthesis:
2-Bromo-6-Fluoro-4-Picoline is used as a key intermediate for the synthesis of various organic compounds. Its unique structure allows for a wide range of chemical reactions, making it a valuable building block in the development of new molecules with specific properties and functions.
Used in Agrochemical Industry:
In the agrochemical industry, 2-Bromo-6-Fluoro-4-Picoline is used as a crucial raw material for the production of various pesticides and other agricultural chemicals. Its incorporation into these products helps improve their effectiveness in controlling pests and diseases, ultimately contributing to increased crop yields and food security.
Used in Pharmaceutical Industry:
2-Bromo-6-Fluoro-4-Picoline plays a significant role in the pharmaceutical industry as a starting material for the development of new drugs. Its unique chemical properties enable the creation of novel drug candidates with potential therapeutic applications, including the treatment of various diseases and medical conditions.
Used in Dyestuff Industry:
In the dyestuff industry, 2-Bromo-6-Fluoro-4-Picoline is utilized as an essential intermediate for the synthesis of various dyes and pigments. Its presence in these compounds contributes to their color properties and stability, making it an important component in the production of high-quality dyes for various applications, such as textiles, plastics, and printing inks.
Check Digit Verification of cas no
The CAS Registry Mumber 180608-37-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,0,6,0 and 8 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 180608-37:
(8*1)+(7*8)+(6*0)+(5*6)+(4*0)+(3*8)+(2*3)+(1*7)=131
131 % 10 = 1
So 180608-37-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BrFN/c1-4-2-5(7)9-6(8)3-4/h2-3H,1H3
