180741-46-2 Usage
Description
3-(5-METHYL-PYRAZOL-1-YL)-PROPIONIC ACID, with the chemical formula C8H10N2O2, is a pyrazole derivative and a member of the propionic acid class. This chemical compound is known for its versatile chemical properties, making it a valuable ingredient in the production of pharmaceutical and chemical products.
Uses
Used in Pharmaceutical Industry:
3-(5-METHYL-PYRAZOL-1-YL)-PROPIONIC ACID is used as a building block for the synthesis of various drugs and pharmaceuticals. Its unique structure and properties allow it to be incorporated into the development of new medications, contributing to the advancement of healthcare and treatment options.
Used in Organic Chemistry:
3-(5-METHYL-PYRAZOL-1-YL)-PROPIONIC ACID is used as a reagent for the preparation of other compounds. Its chemical versatility enables it to be a key component in the synthesis of a wide range of organic compounds, further expanding its applications across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 180741-46-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,0,7,4 and 1 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 180741-46:
(8*1)+(7*8)+(6*0)+(5*7)+(4*4)+(3*1)+(2*4)+(1*6)=132
132 % 10 = 2
So 180741-46-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O2/c1-6-2-4-8-9(6)5-3-7(10)11/h2,4H,3,5H2,1H3,(H,10,11)
